C24H17BrN2O7 — CID 4216564
5-bromo-2-[5-[[1-(4-ethoxycarbonylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 4216564) has the molecular formula C24H17BrN2O7 and a molecular weight of 525.31 g/mol. Its IUPAC name is 5-bromo-2-[5-[[1-(4-ethoxycarbonylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 5-bromo-2-[5-[[1-(4-ethoxycarbonylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4216564 |
| Molecular Formula | C24H17BrN2O7 |
| Molecular Weight | 525.31 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | 5-bromo-2-[5-[[1-(4-ethoxycarbonylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | CCOC(=O)c1ccc(N2NC(=O)C(=Cc3ccc(-c4ccc(Br)cc4C(=O)O)o3)C2=O)cc1 |
| InChI | InChI=1S/C24H17BrN2O7/c1-2-33-24(32)13-3-6-15(7-4-13)27-22(29)19(21(28)26-27)12-16-8-10-20(34-16)17-9-5-14(25)11-18(17)23(30)31/h3-12H,2H2,1H3,(H,26,28)(H,30,31) |
| InChIKey | FQJOGTZGTMSFHO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|