C23H16ClFN2O5 — CID 21231152
ethyl 2-chloro-5-[5-[(Z)-[1-(4-fluorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 21231152) has the molecular formula C23H16ClFN2O5 and a molecular weight of 454.84 g/mol. Its IUPAC name is ethyl 2-chloro-5-[5-[(Z)-[1-(4-fluorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 2-chloro-5-[5-[(Z)-[1-(4-fluorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 21231152 |
| Molecular Formula | C23H16ClFN2O5 |
| Molecular Weight | 454.84 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | ethyl 2-chloro-5-[5-[(Z)-[1-(4-fluorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(/C=C3/C(=O)NN(c4ccc(F)cc4)C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C23H16ClFN2O5/c1-2-31-23(30)17-11-13(3-9-19(17)24)20-10-8-16(32-20)12-18-21(28)26-27(22(18)29)15-6-4-14(25)5-7-15/h3-12H,2H2,1H3,(H,26,28)/b18-12- |
| InChIKey | DKWXEEDNIMJWGT-PDGQHHTCSA-N |
| XLogP | 4.38 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|