C27H24N2O7 — CID 126015890
ethyl 4-[5-[(Z)-[1-(2-methoxyethyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126015890) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-[1-(2-methoxyethyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-[1-(2-methoxyethyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126015890 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | ethyl 4-[5-[(Z)-[1-(2-methoxyethyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C3/C(=O)N(CCOC)C(=O)N(c4ccccc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C27H24N2O7/c1-3-35-26(32)19-11-9-18(10-12-19)23-14-13-21(36-23)17-22-24(30)28(15-16-34-2)27(33)29(25(22)31)20-7-5-4-6-8-20/h4-14,17H,3,15-16H2,1-2H3/b22-17- |
| InChIKey | CYPFHNXEPIKFAU-XLNRJJMWSA-N |
| XLogP | 4.15 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|