C36H27NO4 — CID 3115734
ethyl 4-[5-[[2-oxo-5-phenyl-1-(4-phenylphenyl)pyrrol-3-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 3115734) has the molecular formula C36H27NO4 and a molecular weight of 537.62 g/mol. Its IUPAC name is ethyl 4-[5-[[2-oxo-5-phenyl-1-(4-phenylphenyl)pyrrol-3-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[2-oxo-5-phenyl-1-(4-phenylphenyl)pyrrol-3-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3115734 |
| Molecular Formula | C36H27NO4 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | ethyl 4-[5-[[2-oxo-5-phenyl-1-(4-phenylphenyl)pyrrol-3-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C3C=C(c4ccccc4)N(c4ccc(-c5ccccc5)cc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C36H27NO4/c1-2-40-36(39)29-15-13-28(14-16-29)34-22-21-32(41-34)23-30-24-33(27-11-7-4-8-12-27)37(35(30)38)31-19-17-26(18-20-31)25-9-5-3-6-10-25/h3-24H,2H2,1H3 |
| InChIKey | IJFZWOPUBCKRTD-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|