C32H27NO4 — CID 3123642
ethyl 4-[5-[[1-(2,5-dimethylphenyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 3123642) has the molecular formula C32H27NO4 and a molecular weight of 489.57 g/mol. Its IUPAC name is ethyl 4-[5-[[1-(2,5-dimethylphenyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[1-(2,5-dimethylphenyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3123642 |
| Molecular Formula | C32H27NO4 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | ethyl 4-[5-[[1-(2,5-dimethylphenyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C3C=C(c4ccccc4)N(c4cc(C)ccc4C)C3=O)o2)cc1 |
| InChI | InChI=1S/C32H27NO4/c1-4-36-32(35)25-14-12-24(13-15-25)30-17-16-27(37-30)19-26-20-29(23-8-6-5-7-9-23)33(31(26)34)28-18-21(2)10-11-22(28)3/h5-20H,4H2,1-3H3 |
| InChIKey | LQXZQDUOZLHNNE-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|