C27H23NO4 — CID 1083587
ethyl 4-[(Z)-[1-(2-methoxyphenyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]benzoate (PubChem CID 1083587) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is ethyl 4-[(Z)-[1-(2-methoxyphenyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]benzoate.
| Compound Name | ethyl 4-[(Z)-[1-(2-methoxyphenyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 1083587 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | ethyl 4-[(Z)-[1-(2-methoxyphenyl)-2-oxo-5-phenylpyrrol-3-ylidene]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/C=C2/C=C(c3ccccc3)N(c3ccccc3OC)C2=O)cc1 |
| InChI | InChI=1S/C27H23NO4/c1-3-32-27(30)21-15-13-19(14-16-21)17-22-18-24(20-9-5-4-6-10-20)28(26(22)29)23-11-7-8-12-25(23)31-2/h4-18H,3H2,1-2H3/b22-17- |
| InChIKey | MKVICTMTYWJDCW-XLNRJJMWSA-N |
| XLogP | 5.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|