C25H18ClNO4 — CID 45105597
2-chloro-5-[(3E)-3-[(4-methoxyphenyl)methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid (PubChem CID 45105597) has the molecular formula C25H18ClNO4 and a molecular weight of 431.88 g/mol. Its IUPAC name is 2-chloro-5-[(3E)-3-[(4-methoxyphenyl)methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[(3E)-3-[(4-methoxyphenyl)methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 45105597 |
| Molecular Formula | C25H18ClNO4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-chloro-5-[(3E)-3-[(4-methoxyphenyl)methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid |
| SMILES | COc1ccc(/C=C2\C=C(c3ccccc3)N(c3ccc(Cl)c(C(=O)O)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H18ClNO4/c1-31-20-10-7-16(8-11-20)13-18-14-23(17-5-3-2-4-6-17)27(24(18)28)19-9-12-22(26)21(15-19)25(29)30/h2-15H,1H3,(H,29,30)/b18-13+ |
| InChIKey | QXWURBAUMIEJCV-QGOAFFKASA-N |
| XLogP | 5.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|