C24H18BrNO2 — CID 6617573
3-[(3-bromo-4-methoxyphenyl)methylidene]-1,5-diphenylpyrrol-2-one (PubChem CID 6617573) has the molecular formula C24H18BrNO2 and a molecular weight of 432.32 g/mol. Its IUPAC name is 3-[(3-bromo-4-methoxyphenyl)methylidene]-1,5-diphenylpyrrol-2-one.
| Compound Name | 3-[(3-bromo-4-methoxyphenyl)methylidene]-1,5-diphenylpyrrol-2-one |
|---|---|
| PubChem CID | 6617573 |
| Molecular Formula | C24H18BrNO2 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 3-[(3-bromo-4-methoxyphenyl)methylidene]-1,5-diphenylpyrrol-2-one |
| SMILES | COc1ccc(C=C2C=C(c3ccccc3)N(c3ccccc3)C2=O)cc1Br |
| InChI | InChI=1S/C24H18BrNO2/c1-28-23-13-12-17(15-21(23)25)14-19-16-22(18-8-4-2-5-9-18)26(24(19)27)20-10-6-3-7-11-20/h2-16H,1H3 |
| InChIKey | DOENNJNBVCRMPD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|