C29H27ClN2O4 — CID 3493724
5-(4-chlorophenyl)-3-[(3,4-dimethoxyphenyl)methylidene]-1-(4-morpholin-4-ylphenyl)pyrrol-2-one (PubChem CID 3493724) has the molecular formula C29H27ClN2O4 and a molecular weight of 503.00 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(3,4-dimethoxyphenyl)methylidene]-1-(4-morpholin-4-ylphenyl)pyrrol-2-one.
| Compound Name | 5-(4-chlorophenyl)-3-[(3,4-dimethoxyphenyl)methylidene]-1-(4-morpholin-4-ylphenyl)pyrrol-2-one |
|---|---|
| PubChem CID | 3493724 |
| Molecular Formula | C29H27ClN2O4 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(3,4-dimethoxyphenyl)methylidene]-1-(4-morpholin-4-ylphenyl)pyrrol-2-one |
| SMILES | COc1ccc(C=C2C=C(c3ccc(Cl)cc3)N(c3ccc(N4CCOCC4)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C29H27ClN2O4/c1-34-27-12-3-20(18-28(27)35-2)17-22-19-26(21-4-6-23(30)7-5-21)32(29(22)33)25-10-8-24(9-11-25)31-13-15-36-16-14-31/h3-12,17-19H,13-16H2,1-2H3 |
| InChIKey | DPNZGGKMUJYGFE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|