C25H17Cl2NO4 — CID 124647005
2-chloro-5-[(3Z)-5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methylidene]-2-oxopyrrol-1-yl]benzoic acid (PubChem CID 124647005) has the molecular formula C25H17Cl2NO4 and a molecular weight of 466.32 g/mol. Its IUPAC name is 2-chloro-5-[(3Z)-5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methylidene]-2-oxopyrrol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[(3Z)-5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methylidene]-2-oxopyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 124647005 |
| Molecular Formula | C25H17Cl2NO4 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 2-chloro-5-[(3Z)-5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methylidene]-2-oxopyrrol-1-yl]benzoic acid |
| SMILES | COc1ccc(/C=C2/C=C(c3ccc(Cl)cc3)N(c3ccc(Cl)c(C(=O)O)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H17Cl2NO4/c1-32-20-9-2-15(3-10-20)12-17-13-23(16-4-6-18(26)7-5-16)28(24(17)29)19-8-11-22(27)21(14-19)25(30)31/h2-14H,1H3,(H,30,31)/b17-12- |
| InChIKey | IQQJOLFDMPBRTC-ATVHPVEESA-N |
| XLogP | 6.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|