C28H17Cl2NO4 — CID 3123639
3-[3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid (PubChem CID 3123639) has the molecular formula C28H17Cl2NO4 and a molecular weight of 502.35 g/mol. Its IUPAC name is 3-[3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid.
| Compound Name | 3-[3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3123639 |
| Molecular Formula | C28H17Cl2NO4 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | 3-[3-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)C(=Cc3ccc(-c4ccc(Cl)c(Cl)c4)o3)C=C2c2ccccc2)c1 |
| InChI | InChI=1S/C28H17Cl2NO4/c29-23-11-9-18(15-24(23)30)26-12-10-22(35-26)14-20-16-25(17-5-2-1-3-6-17)31(27(20)32)21-8-4-7-19(13-21)28(33)34/h1-16H,(H,33,34) |
| InChIKey | SLDWYMPIBZCJHK-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|