C27H18ClNO2 — CID 3115699
3-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-1,5-diphenylpyrrol-2-one (PubChem CID 3115699) has the molecular formula C27H18ClNO2 and a molecular weight of 423.90 g/mol. Its IUPAC name is 3-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-1,5-diphenylpyrrol-2-one.
| Compound Name | 3-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-1,5-diphenylpyrrol-2-one |
|---|---|
| PubChem CID | 3115699 |
| Molecular Formula | C27H18ClNO2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 3-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-1,5-diphenylpyrrol-2-one |
| SMILES | O=C1C(=Cc2ccc(-c3cccc(Cl)c3)o2)C=C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C27H18ClNO2/c28-22-11-7-10-20(16-22)26-15-14-24(31-26)17-21-18-25(19-8-3-1-4-9-19)29(27(21)30)23-12-5-2-6-13-23/h1-18H |
| InChIKey | DRLQEIQFMLWSMR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|