C22H14Cl2N2O5 — CID 50885149
5-[(4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-hydroxybenzoic acid (PubChem CID 50885149) has the molecular formula C22H14Cl2N2O5 and a molecular weight of 457.27 g/mol. Its IUPAC name is 5-[(4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 50885149 |
| Molecular Formula | C22H14Cl2N2O5 |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 5-[(4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-hydroxybenzoic acid |
| SMILES | CC1=NN(c2ccc(O)c(C(=O)O)c2)C(=O)/C1=C\c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C22H14Cl2N2O5/c1-11-16(10-14-4-7-20(31-14)15-5-2-12(23)8-18(15)24)21(28)26(25-11)13-3-6-19(27)17(9-13)22(29)30/h2-10,27H,1H3,(H,29,30)/b16-10- |
| InChIKey | NPZZEVALKNZZLM-YBEGLDIGSA-N |
| XLogP | 5.46 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|