C17H9Cl3N2O3 — CID 1237685
1-(4-chlorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1237685) has the molecular formula C17H9Cl3N2O3 and a molecular weight of 395.63 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-chlorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1237685 |
| Molecular Formula | C17H9Cl3N2O3 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[(2,4-dichlorophenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc(Cl)cc2)C(=O)C1=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H9Cl3N2O3/c18-10-3-5-12(6-4-10)22-16(24)13(15(23)21-17(22)25)7-9-1-2-11(19)8-14(9)20/h1-8H,(H,21,23,25) |
| InChIKey | LTBOBBZKPODHCJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|