C22H20Cl2N2O5 — CID 126209826
(5E)-5-[(2,4-dichlorophenyl)methylidene]-1-(3-ethoxy-4-propoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126209826) has the molecular formula C22H20Cl2N2O5 and a molecular weight of 463.32 g/mol. Its IUPAC name is (5E)-5-[(2,4-dichlorophenyl)methylidene]-1-(3-ethoxy-4-propoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-1-(3-ethoxy-4-propoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126209826 |
| Molecular Formula | C22H20Cl2N2O5 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | (5E)-5-[(2,4-dichlorophenyl)methylidene]-1-(3-ethoxy-4-propoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(N2C(=O)NC(=O)/C(=C\c3ccc(Cl)cc3Cl)C2=O)cc1OCC |
| InChI | InChI=1S/C22H20Cl2N2O5/c1-3-9-31-18-8-7-15(12-19(18)30-4-2)26-21(28)16(20(27)25-22(26)29)10-13-5-6-14(23)11-17(13)24/h5-8,10-12H,3-4,9H2,1-2H3,(H,25,27,29)/b16-10+ |
| InChIKey | ZDEUTVXEWHQSJE-MHWRWJLKSA-N |
| XLogP | 4.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|