C39H27Cl2N3O3 — CID 155814828
10-[(2R)-3-[3-[(Z)-[1-(2,6-dichlorophenyl)-2-oxoindol-3-ylidene]methyl]indol-1-yl]-2-hydroxypropyl]acridin-9-one (PubChem CID 155814828) has the molecular formula C39H27Cl2N3O3 and a molecular weight of 656.57 g/mol. Its IUPAC name is 10-[(2R)-3-[3-[(Z)-[1-(2,6-dichlorophenyl)-2-oxoindol-3-ylidene]methyl]indol-1-yl]-2-hydroxypropyl]acridin-9-one.
| Compound Name | 10-[(2R)-3-[3-[(Z)-[1-(2,6-dichlorophenyl)-2-oxoindol-3-ylidene]methyl]indol-1-yl]-2-hydroxypropyl]acridin-9-one |
|---|---|
| PubChem CID | 155814828 |
| Molecular Formula | C39H27Cl2N3O3 |
| Molecular Weight | 656.57 g/mol |
| Exact Mass | 655.14 |
| IUPAC Name | 10-[(2R)-3-[3-[(Z)-[1-(2,6-dichlorophenyl)-2-oxoindol-3-ylidene]methyl]indol-1-yl]-2-hydroxypropyl]acridin-9-one |
| SMILES | O=C1/C(=C\c2cn(C[C@@H](O)Cn3c4ccccc4c(=O)c4ccccc43)c3ccccc23)c2ccccc2N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C39H27Cl2N3O3/c40-31-14-9-15-32(41)37(31)44-36-19-8-2-11-27(36)30(39(44)47)20-24-21-42(33-16-5-1-10-26(24)33)22-25(45)23-43-34-17-6-3-12-28(34)38(46)29-13-4-7-18-35(29)43/h1-21,25,45H,22-23H2/b30-20-/t25-/m1/s1 |
| InChIKey | QPCNEYYEITXFPY-QAVZPZIDSA-N |
| XLogP | 8.70 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.57 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|