C19H26N2O2 — CID 7372032
1-[(2S)-3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-hydroxypropyl]indole-3-carbaldehyde (PubChem CID 7372032) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[(2S)-3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-hydroxypropyl]indole-3-carbaldehyde.
| Compound Name | 1-[(2S)-3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-hydroxypropyl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 7372032 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-[(2S)-3-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-hydroxypropyl]indole-3-carbaldehyde |
| SMILES | C[C@@H]1C[C@H](C)CN(C[C@H](O)Cn2cc(C=O)c3ccccc32)C1 |
| InChI | InChI=1S/C19H26N2O2/c1-14-7-15(2)9-20(8-14)11-17(23)12-21-10-16(13-22)18-5-3-4-6-19(18)21/h3-6,10,13-15,17,23H,7-9,11-12H2,1-2H3/t14-,15+,17-/m0/s1 |
| InChIKey | BQTCNQYCRFWEKT-UXLLHSPISA-N |
| XLogP | 2.79 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|