C20H19NO5 — CID 40542272
methyl 4-[(2S)-3-(3-formylindol-1-yl)-2-hydroxypropoxy]benzoate (PubChem CID 40542272) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is methyl 4-[(2S)-3-(3-formylindol-1-yl)-2-hydroxypropoxy]benzoate.
| Compound Name | methyl 4-[(2S)-3-(3-formylindol-1-yl)-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 40542272 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | methyl 4-[(2S)-3-(3-formylindol-1-yl)-2-hydroxypropoxy]benzoate |
| SMILES | COC(=O)c1ccc(OC[C@@H](O)Cn2cc(C=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H19NO5/c1-25-20(24)14-6-8-17(9-7-14)26-13-16(23)11-21-10-15(12-22)18-4-2-3-5-19(18)21/h2-10,12,16,23H,11,13H2,1H3/t16-/m0/s1 |
| InChIKey | OIFPSNOOFCCVAU-INIZCTEOSA-N |
| XLogP | 2.68 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|