C25H22N2O5 — CID 46529511
methyl 4-[2-hydroxy-3-(1-oxo-4-phenylphthalazin-2-yl)propoxy]benzoate (PubChem CID 46529511) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is methyl 4-[2-hydroxy-3-(1-oxo-4-phenylphthalazin-2-yl)propoxy]benzoate.
| Compound Name | methyl 4-[2-hydroxy-3-(1-oxo-4-phenylphthalazin-2-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 46529511 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | methyl 4-[2-hydroxy-3-(1-oxo-4-phenylphthalazin-2-yl)propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(O)Cn2nc(-c3ccccc3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H22N2O5/c1-31-25(30)18-11-13-20(14-12-18)32-16-19(28)15-27-24(29)22-10-6-5-9-21(22)23(26-27)17-7-3-2-4-8-17/h2-14,19,28H,15-16H2,1H3 |
| InChIKey | LQCCAIIJHRRZBP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |