C23H20N2O3 — CID 24651197
2-(2-hydroxy-3-phenoxypropyl)-4-phenylphthalazin-1-one (PubChem CID 24651197) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-(2-hydroxy-3-phenoxypropyl)-4-phenylphthalazin-1-one.
| Compound Name | 2-(2-hydroxy-3-phenoxypropyl)-4-phenylphthalazin-1-one |
|---|---|
| PubChem CID | 24651197 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-(2-hydroxy-3-phenoxypropyl)-4-phenylphthalazin-1-one |
| SMILES | O=c1c2ccccc2c(-c2ccccc2)nn1CC(O)COc1ccccc1 |
| InChI | InChI=1S/C23H20N2O3/c26-18(16-28-19-11-5-2-6-12-19)15-25-23(27)21-14-8-7-13-20(21)22(24-25)17-9-3-1-4-10-17/h1-14,18,26H,15-16H2 |
| InChIKey | NACYTLMIVDZIOP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |