About 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one
2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one (PubChem CID 26011478) has the molecular formula C23H18Cl2N2O3
and a molecular weight of 441.31 g/mol. Its IUPAC name is 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one.
Molecular Properties
| Compound Name | 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one |
| PubChem CID | 26011478 |
| Molecular Formula | C23H18Cl2N2O3 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one |
| SMILES | O=c1c2ccccc2c(-c2ccccc2)nn1C[C@@H](O)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H18Cl2N2O3/c24-16-10-11-20(25)21(12-16)30-14-17(28)13-27-23(29)19-9-5-4-8-18(19)22(26-27)15-6-2-1-3-7-15/h1-12,17,28H,13-14H2/t17-/m1/s1 |
| InChIKey | SMXJGLUMLAJEDS-QGZVFWFLSA-N |
| XLogP | 4.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one?
The IUPAC name of 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one (CID 26011478) is 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one.
What is the SMILES notation for 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one?
The canonical SMILES for 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one is O=c1c2ccccc2c(-c2ccccc2)nn1C[C@@H](O)COc1cc(Cl)ccc1Cl.
What is the InChIKey of 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one?
The InChIKey is SMXJGLUMLAJEDS-QGZVFWFLSA-N. The full InChI is InChI=1S/C23H18Cl2N2O3/c24-16-10-11-20(25)21(12-16)30-14-17(28)13-27-23(29)19-9-5-4-8-18(19)22(26-27)15-6-2-1-3-7-15/h1-12,17,28H,13-14H2/t17-/m1/s1.
What are the key properties of 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one?
2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one has a molecular weight of 441.31 g/mol, XLogP of 4.81, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-4-phenylphthalazin-1-one is sourced from PubChem (CID 26011478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).