C27H28N2O3 — CID 46529535
2-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-4-(4-methylphenyl)phthalazin-1-one (PubChem CID 46529535) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-4-(4-methylphenyl)phthalazin-1-one.
| Compound Name | 2-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-4-(4-methylphenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 46529535 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-4-(4-methylphenyl)phthalazin-1-one |
| SMILES | Cc1ccc(-c2nn(CC(O)COc3ccccc3C(C)C)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-18(2)22-8-6-7-11-25(22)32-17-21(30)16-29-27(31)24-10-5-4-9-23(24)26(28-29)20-14-12-19(3)13-15-20/h4-15,18,21,30H,16-17H2,1-3H3 |
| InChIKey | WKJOBFFYYKZTFK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |