C22H16F2N2O2 — CID 94600109
4-(3,4-difluorophenyl)-2-[(2R)-2-hydroxy-2-phenylethyl]phthalazin-1-one (PubChem CID 94600109) has the molecular formula C22H16F2N2O2 and a molecular weight of 378.38 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-[(2R)-2-hydroxy-2-phenylethyl]phthalazin-1-one.
| Compound Name | 4-(3,4-difluorophenyl)-2-[(2R)-2-hydroxy-2-phenylethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 94600109 |
| Molecular Formula | C22H16F2N2O2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-[(2R)-2-hydroxy-2-phenylethyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2c(-c2ccc(F)c(F)c2)nn1C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H16F2N2O2/c23-18-11-10-15(12-19(18)24)21-16-8-4-5-9-17(16)22(28)26(25-21)13-20(27)14-6-2-1-3-7-14/h1-12,20,27H,13H2/t20-/m0/s1 |
| InChIKey | PHGGHOKSWQIKNZ-FQEVSTJZSA-N |
| XLogP | 4.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |