About 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide
3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide (PubChem CID 110897787) has the molecular formula C17H13F2N3O3
and a molecular weight of 345.31 g/mol. Its IUPAC name is 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide.
Molecular Properties
| Compound Name | 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide |
| PubChem CID | 110897787 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide |
| SMILES | NC(=O)c1nn(CC(O)c2ccc(F)c(F)c2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H13F2N3O3/c18-12-6-5-9(7-13(12)19)14(23)8-22-17(25)11-4-2-1-3-10(11)15(21-22)16(20)24/h1-7,14,23H,8H2,(H2,20,24) |
| InChIKey | MKUADXNTYKPISC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide?
The IUPAC name of 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide (CID 110897787) is 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide.
What is the SMILES notation for 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide?
The canonical SMILES for 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide is NC(=O)c1nn(CC(O)c2ccc(F)c(F)c2)c(=O)c2ccccc12.
What is the InChIKey of 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide?
The InChIKey is MKUADXNTYKPISC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2N3O3/c18-12-6-5-9(7-13(12)19)14(23)8-22-17(25)11-4-2-1-3-10(11)15(21-22)16(20)24/h1-7,14,23H,8H2,(H2,20,24).
What are the key properties of 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide?
3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide has a molecular weight of 345.31 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-difluorophenyl)-2-hydroxyethyl]-4-oxophthalazine-1-carboxamide is sourced from PubChem (CID 110897787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).