C40H40N2O2P+ — CID 127045979
4-[4-[3-(2-methylpropyl)-4-oxophthalazin-1-yl]phenoxy]butyl-triphenylphosphanium (PubChem CID 127045979) has the molecular formula C40H40N2O2P+ and a molecular weight of 611.75 g/mol. Its IUPAC name is 4-[4-[3-(2-methylpropyl)-4-oxophthalazin-1-yl]phenoxy]butyl-triphenylphosphanium.
| Compound Name | 4-[4-[3-(2-methylpropyl)-4-oxophthalazin-1-yl]phenoxy]butyl-triphenylphosphanium |
|---|---|
| PubChem CID | 127045979 |
| Molecular Formula | C40H40N2O2P+ |
| Molecular Weight | 611.75 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | 4-[4-[3-(2-methylpropyl)-4-oxophthalazin-1-yl]phenoxy]butyl-triphenylphosphanium |
| SMILES | CC(C)Cn1nc(-c2ccc(OCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C40H40N2O2P/c1-31(2)30-42-40(43)38-23-13-12-22-37(38)39(41-42)32-24-26-33(27-25-32)44-28-14-15-29-45(34-16-6-3-7-17-34,35-18-8-4-9-19-35)36-20-10-5-11-21-36/h3-13,16-27,31H,14-15,28-30H2,1-2H3/q+1 |
| InChIKey | VDOGRODDBMYDND-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.75 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|