C38H36N2O2P+ — CID 127045970
4-[4-(3-ethyl-4-oxophthalazin-1-yl)phenoxy]butyl-triphenylphosphanium (PubChem CID 127045970) has the molecular formula C38H36N2O2P+ and a molecular weight of 583.69 g/mol. Its IUPAC name is 4-[4-(3-ethyl-4-oxophthalazin-1-yl)phenoxy]butyl-triphenylphosphanium.
| Compound Name | 4-[4-(3-ethyl-4-oxophthalazin-1-yl)phenoxy]butyl-triphenylphosphanium |
|---|---|
| PubChem CID | 127045970 |
| Molecular Formula | C38H36N2O2P+ |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 4-[4-(3-ethyl-4-oxophthalazin-1-yl)phenoxy]butyl-triphenylphosphanium |
| SMILES | CCn1nc(-c2ccc(OCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C38H36N2O2P/c1-2-40-38(41)36-23-13-12-22-35(36)37(39-40)30-24-26-31(27-25-30)42-28-14-15-29-43(32-16-6-3-7-17-32,33-18-8-4-9-19-33)34-20-10-5-11-21-34/h3-13,16-27H,2,14-15,28-29H2,1H3/q+1 |
| InChIKey | SHSDQAKWXOICEZ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|