C23H20N2O5S — CID 46632806
methyl 4-[2-hydroxy-3-(1-oxo-4-thiophen-2-ylphthalazin-2-yl)propoxy]benzoate (PubChem CID 46632806) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is methyl 4-[2-hydroxy-3-(1-oxo-4-thiophen-2-ylphthalazin-2-yl)propoxy]benzoate.
| Compound Name | methyl 4-[2-hydroxy-3-(1-oxo-4-thiophen-2-ylphthalazin-2-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 46632806 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | methyl 4-[2-hydroxy-3-(1-oxo-4-thiophen-2-ylphthalazin-2-yl)propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(O)Cn2nc(-c3cccs3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H20N2O5S/c1-29-23(28)15-8-10-17(11-9-15)30-14-16(26)13-25-22(27)19-6-3-2-5-18(19)21(24-25)20-7-4-12-31-20/h2-12,16,26H,13-14H2,1H3 |
| InChIKey | AHSBEXXHBVVSHJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |