C25H24N2O4S — CID 30686543
2-[(2R)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-4-thiophen-2-ylphthalazin-1-one (PubChem CID 30686543) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[(2R)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-4-thiophen-2-ylphthalazin-1-one.
| Compound Name | 2-[(2R)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-4-thiophen-2-ylphthalazin-1-one |
|---|---|
| PubChem CID | 30686543 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-[(2R)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-4-thiophen-2-ylphthalazin-1-one |
| SMILES | C=CCc1ccc(OC[C@H](O)Cn2nc(-c3cccs3)c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C25H24N2O4S/c1-3-7-17-11-12-21(22(14-17)30-2)31-16-18(28)15-27-25(29)20-9-5-4-8-19(20)24(26-27)23-10-6-13-32-23/h3-6,8-14,18,28H,1,7,15-16H2,2H3/t18-/m1/s1 |
| InChIKey | MXIXOPYAQMFIRJ-GOSISDBHSA-N |
| XLogP | 4.30 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|