C27H28N2O5S — CID 24606427
1-[2-(benzenesulfonylmethyl)benzimidazol-1-yl]-3-(2-methoxy-4-prop-2-enylphenoxy)propan-2-ol (PubChem CID 24606427) has the molecular formula C27H28N2O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is 1-[2-(benzenesulfonylmethyl)benzimidazol-1-yl]-3-(2-methoxy-4-prop-2-enylphenoxy)propan-2-ol.
| Compound Name | 1-[2-(benzenesulfonylmethyl)benzimidazol-1-yl]-3-(2-methoxy-4-prop-2-enylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 24606427 |
| Molecular Formula | C27H28N2O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 1-[2-(benzenesulfonylmethyl)benzimidazol-1-yl]-3-(2-methoxy-4-prop-2-enylphenoxy)propan-2-ol |
| SMILES | C=CCc1ccc(OCC(O)Cn2c(CS(=O)(=O)c3ccccc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C27H28N2O5S/c1-3-9-20-14-15-25(26(16-20)33-2)34-18-21(30)17-29-24-13-8-7-12-23(24)28-27(29)19-35(31,32)22-10-5-4-6-11-22/h3-8,10-16,21,30H,1,9,17-19H2,2H3 |
| InChIKey | KKMOOYMEHABIAU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|