C19H30Cl2N2O4-2 — CID 21237632
1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-(2-methoxy-4-prop-2-enylphenoxy)propan-2-ol dichloride (PubChem CID 21237632) has the molecular formula C19H30Cl2N2O4-2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-(2-methoxy-4-prop-2-enylphenoxy)propan-2-ol dichloride.
| Compound Name | 1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-(2-methoxy-4-prop-2-enylphenoxy)propan-2-ol dichloride |
|---|---|
| PubChem CID | 21237632 |
| Molecular Formula | C19H30Cl2N2O4-2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-(2-methoxy-4-prop-2-enylphenoxy)propan-2-ol dichloride |
| SMILES | C=CCc1ccc(OCC(O)CN2CCN(CCO)CC2)c(OC)c1.[Cl-].[Cl-] |
| InChI | InChI=1S/C19H30N2O4.2ClH/c1-3-4-16-5-6-18(19(13-16)24-2)25-15-17(23)14-21-9-7-20(8-10-21)11-12-22;;/h3,5-6,13,17,22-23H,1,4,7-12,14-15H2,2H3;2*1H/p-2 |
| InChIKey | ZPAJKACSLCDIQZ-UHFFFAOYSA-L |
| XLogP | -5.22 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | -5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|