C16H23N2O2+ — CID 2147197
tert-butyl-[(2S)-3-(3-formylindol-1-yl)-2-hydroxypropyl]azanium (PubChem CID 2147197) has the molecular formula C16H23N2O2+ and a molecular weight of 275.37 g/mol. Its IUPAC name is tert-butyl-[(2S)-3-(3-formylindol-1-yl)-2-hydroxypropyl]azanium.
| Compound Name | tert-butyl-[(2S)-3-(3-formylindol-1-yl)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 2147197 |
| Molecular Formula | C16H23N2O2+ |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | tert-butyl-[(2S)-3-(3-formylindol-1-yl)-2-hydroxypropyl]azanium |
| SMILES | CC(C)(C)[NH2+]C[C@H](O)Cn1cc(C=O)c2ccccc21 |
| InChI | InChI=1S/C16H22N2O2/c1-16(2,3)17-8-13(20)10-18-9-12(11-19)14-6-4-5-7-15(14)18/h4-7,9,11,13,17,20H,8,10H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | AXZGRYWTUSUHTJ-ZDUSSCGKSA-O |
| XLogP | 1.18 |
| TPSA | 58.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|