C20H22N2O4S — CID 40542239
N-[(2R)-3-(3-formylindol-1-yl)-2-hydroxypropyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 40542239) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[(2R)-3-(3-formylindol-1-yl)-2-hydroxypropyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(2R)-3-(3-formylindol-1-yl)-2-hydroxypropyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 40542239 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[(2R)-3-(3-formylindol-1-yl)-2-hydroxypropyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C[C@H](O)Cn2cc(C=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-15-7-9-18(10-8-15)27(25,26)21(2)12-17(24)13-22-11-16(14-23)19-5-3-4-6-20(19)22/h3-11,14,17,24H,12-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | QCYPTICLOSMUBZ-KRWDZBQOSA-N |
| XLogP | 2.44 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|