C18H25N3O2 — CID 18590376
1-[3-[(Z)-hydroxyiminomethyl]indol-1-yl]-3-(4-methylpiperidin-1-yl)propan-2-ol (PubChem CID 18590376) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-[3-[(Z)-hydroxyiminomethyl]indol-1-yl]-3-(4-methylpiperidin-1-yl)propan-2-ol.
| Compound Name | 1-[3-[(Z)-hydroxyiminomethyl]indol-1-yl]-3-(4-methylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 18590376 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-[3-[(Z)-hydroxyiminomethyl]indol-1-yl]-3-(4-methylpiperidin-1-yl)propan-2-ol |
| SMILES | CC1CCN(CC(O)Cn2cc(/C=N\O)c3ccccc32)CC1 |
| InChI | InChI=1S/C18H25N3O2/c1-14-6-8-20(9-7-14)12-16(22)13-21-11-15(10-19-23)17-4-2-3-5-18(17)21/h2-5,10-11,14,16,22-23H,6-9,12-13H2,1H3/b19-10- |
| InChIKey | AHXPPVHLSYEQQZ-GRSHGNNSSA-N |
| XLogP | 2.54 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|