C16H21N3O4 — CID 71683435
2-[[2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]indol-1-yl]propyl]amino]butanoic acid (PubChem CID 71683435) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]indol-1-yl]propyl]amino]butanoic acid.
| Compound Name | 2-[[2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]indol-1-yl]propyl]amino]butanoic acid |
|---|---|
| PubChem CID | 71683435 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[[2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]indol-1-yl]propyl]amino]butanoic acid |
| SMILES | CCC(NCC(O)Cn1cc(/C=N/O)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C16H21N3O4/c1-2-14(16(21)22)17-8-12(20)10-19-9-11(7-18-23)13-5-3-4-6-15(13)19/h3-7,9,12,14,17,20,23H,2,8,10H2,1H3,(H,21,22)/b18-7+ |
| InChIKey | ATQJFHMIOYUAQT-CNHKJKLMSA-N |
| XLogP | 1.26 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|