C26H33N2O2+ — CID 7103742
[(2S)-2-hydroxy-3-[3-[(E)-3-oxo-3-phenylprop-1-enyl]indol-1-yl]propyl]-dipropylazanium (PubChem CID 7103742) has the molecular formula C26H33N2O2+ and a molecular weight of 405.56 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[3-[(E)-3-oxo-3-phenylprop-1-enyl]indol-1-yl]propyl]-dipropylazanium.
| Compound Name | [(2S)-2-hydroxy-3-[3-[(E)-3-oxo-3-phenylprop-1-enyl]indol-1-yl]propyl]-dipropylazanium |
|---|---|
| PubChem CID | 7103742 |
| Molecular Formula | C26H33N2O2+ |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | [(2S)-2-hydroxy-3-[3-[(E)-3-oxo-3-phenylprop-1-enyl]indol-1-yl]propyl]-dipropylazanium |
| SMILES | CCC[NH+](CCC)C[C@@H](O)Cn1cc(/C=C/C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H32N2O2/c1-3-16-27(17-4-2)19-23(29)20-28-18-22(24-12-8-9-13-25(24)28)14-15-26(30)21-10-6-5-7-11-21/h5-15,18,23,29H,3-4,16-17,19-20H2,1-2H3/p+1/b15-14+/t23-/m1/s1 |
| InChIKey | VMANASJNJCMQIT-WOOPDLCSSA-O |
| XLogP | 3.60 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|