C32H33N3O2 — CID 6223387
(E)-3-[1-[2-hydroxy-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]propyl]indol-3-yl]-1-(4-methylphenyl)prop-2-en-1-one (PubChem CID 6223387) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is (E)-3-[1-[2-hydroxy-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]propyl]indol-3-yl]-1-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[1-[2-hydroxy-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]propyl]indol-3-yl]-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6223387 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | (E)-3-[1-[2-hydroxy-3-[2-(5-methyl-1H-indol-3-yl)ethylamino]propyl]indol-3-yl]-1-(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C/c2cn(CC(O)CNCCc3c[nH]c4ccc(C)cc34)c3ccccc23)cc1 |
| InChI | InChI=1S/C32H33N3O2/c1-22-7-10-24(11-8-22)32(37)14-12-26-20-35(31-6-4-3-5-28(26)31)21-27(36)19-33-16-15-25-18-34-30-13-9-23(2)17-29(25)30/h3-14,17-18,20,27,33-34,36H,15-16,19,21H2,1-2H3/b14-12+ |
| InChIKey | RHBCJHIWKXPQJK-WYMLVPIESA-N |
| XLogP | 5.83 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|