C26H24N2O — CID 17271930
(Z)-N-[2-(5-methyl-1H-indol-3-yl)ethyl]-2,3-diphenylprop-2-enamide (PubChem CID 17271930) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is (Z)-N-[2-(5-methyl-1H-indol-3-yl)ethyl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[2-(5-methyl-1H-indol-3-yl)ethyl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 17271930 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (Z)-N-[2-(5-methyl-1H-indol-3-yl)ethyl]-2,3-diphenylprop-2-enamide |
| SMILES | Cc1ccc2[nH]cc(CCNC(=O)/C(=C\c3ccccc3)c3ccccc3)c2c1 |
| InChI | InChI=1S/C26H24N2O/c1-19-12-13-25-23(16-19)22(18-28-25)14-15-27-26(29)24(21-10-6-3-7-11-21)17-20-8-4-2-5-9-20/h2-13,16-18,28H,14-15H2,1H3,(H,27,29)/b24-17- |
| InChIKey | YULPLNGZUDCSSY-ULJHMMPZSA-N |
| XLogP | 5.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|