C27H23N3O — CID 17271835
N-[2-(5-methyl-1H-indol-3-yl)ethyl]-2-phenylquinoline-4-carboxamide (PubChem CID 17271835) has the molecular formula C27H23N3O and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[2-(5-methyl-1H-indol-3-yl)ethyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[2-(5-methyl-1H-indol-3-yl)ethyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 17271835 |
| Molecular Formula | C27H23N3O |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[2-(5-methyl-1H-indol-3-yl)ethyl]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1ccc2[nH]cc(CCNC(=O)c3cc(-c4ccccc4)nc4ccccc34)c2c1 |
| InChI | InChI=1S/C27H23N3O/c1-18-11-12-24-22(15-18)20(17-29-24)13-14-28-27(31)23-16-26(19-7-3-2-4-8-19)30-25-10-6-5-9-21(23)25/h2-12,15-17,29H,13-14H2,1H3,(H,28,31) |
| InChIKey | UXULRKDIIVCMDB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |