C29H27N3O3 — CID 71214926
N-[2-(1H-indol-3-yl)ethyl]-6-methoxy-2-(4-methoxy-3-methylphenyl)quinoline-4-carboxamide (PubChem CID 71214926) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-6-methoxy-2-(4-methoxy-3-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-6-methoxy-2-(4-methoxy-3-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 71214926 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-6-methoxy-2-(4-methoxy-3-methylphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc2nc(-c3ccc(OC)c(C)c3)cc(C(=O)NCCc3c[nH]c4ccccc34)c2c1 |
| InChI | InChI=1S/C29H27N3O3/c1-18-14-19(8-11-28(18)35-3)27-16-24(23-15-21(34-2)9-10-26(23)32-27)29(33)30-13-12-20-17-31-25-7-5-4-6-22(20)25/h4-11,14-17,31H,12-13H2,1-3H3,(H,30,33) |
| InChIKey | ACKZTEUNTZPKLA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |