C29H26N4O3 — CID 56588245
2-amino-5-benzoyl-N-[2-(1H-indol-3-yl)ethyl]-4-(4-methoxyphenyl)-1H-pyrrole-3-carboxamide (PubChem CID 56588245) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-amino-5-benzoyl-N-[2-(1H-indol-3-yl)ethyl]-4-(4-methoxyphenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 2-amino-5-benzoyl-N-[2-(1H-indol-3-yl)ethyl]-4-(4-methoxyphenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 56588245 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-amino-5-benzoyl-N-[2-(1H-indol-3-yl)ethyl]-4-(4-methoxyphenyl)-1H-pyrrole-3-carboxamide |
| SMILES | COc1ccc(-c2c(C(=O)c3ccccc3)[nH]c(N)c2C(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C29H26N4O3/c1-36-21-13-11-18(12-14-21)24-25(28(30)33-26(24)27(34)19-7-3-2-4-8-19)29(35)31-16-15-20-17-32-23-10-6-5-9-22(20)23/h2-14,17,32-33H,15-16,30H2,1H3,(H,31,35) |
| InChIKey | AWPQVVOREUIASC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |