C20H22N2OS — CID 17272014
N-[2-(5-methyl-1H-indol-3-yl)ethyl]-3-phenylsulfanylpropanamide (PubChem CID 17272014) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is N-[2-(5-methyl-1H-indol-3-yl)ethyl]-3-phenylsulfanylpropanamide.
| Compound Name | N-[2-(5-methyl-1H-indol-3-yl)ethyl]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 17272014 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[2-(5-methyl-1H-indol-3-yl)ethyl]-3-phenylsulfanylpropanamide |
| SMILES | Cc1ccc2[nH]cc(CCNC(=O)CCSc3ccccc3)c2c1 |
| InChI | InChI=1S/C20H22N2OS/c1-15-7-8-19-18(13-15)16(14-22-19)9-11-21-20(23)10-12-24-17-5-3-2-4-6-17/h2-8,13-14,22H,9-12H2,1H3,(H,21,23) |
| InChIKey | IMKYERRKMMZQDR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |