C27H25N3O2S — CID 2875968
N-[3-[2-(1H-indol-3-yl)ethylamino]-1-(4-methylsulfanylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 2875968) has the molecular formula C27H25N3O2S and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[3-[2-(1H-indol-3-yl)ethylamino]-1-(4-methylsulfanylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-(1H-indol-3-yl)ethylamino]-1-(4-methylsulfanylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 2875968 |
| Molecular Formula | C27H25N3O2S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[3-[2-(1H-indol-3-yl)ethylamino]-1-(4-methylsulfanylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CSc1ccc(C=C(NC(=O)c2ccccc2)C(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H25N3O2S/c1-33-22-13-11-19(12-14-22)17-25(30-26(31)20-7-3-2-4-8-20)27(32)28-16-15-21-18-29-24-10-6-5-9-23(21)24/h2-14,17-18,29H,15-16H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | COHDQRCFJNBZFQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|