C28H27N3O2S — CID 3346912
3-[1-[2-hydroxy-3-[2-(1H-indol-3-yl)ethylamino]propyl]indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one (PubChem CID 3346912) has the molecular formula C28H27N3O2S and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-[1-[2-hydroxy-3-[2-(1H-indol-3-yl)ethylamino]propyl]indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one.
| Compound Name | 3-[1-[2-hydroxy-3-[2-(1H-indol-3-yl)ethylamino]propyl]indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 3346912 |
| Molecular Formula | C28H27N3O2S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 3-[1-[2-hydroxy-3-[2-(1H-indol-3-yl)ethylamino]propyl]indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1cn(CC(O)CNCCc2c[nH]c3ccccc23)c2ccccc12)c1cccs1 |
| InChI | InChI=1S/C28H27N3O2S/c32-22(17-29-14-13-20-16-30-25-8-3-1-6-23(20)25)19-31-18-21(24-7-2-4-9-26(24)31)11-12-27(33)28-10-5-15-34-28/h1-12,15-16,18,22,29-30,32H,13-14,17,19H2 |
| InChIKey | AULOXSKXIGDYQL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|