C26H34N2O2S — CID 92669598
(E)-3-[1-[(2R)-3-[bis(2-methylpropyl)amino]-2-hydroxypropyl]indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one (PubChem CID 92669598) has the molecular formula C26H34N2O2S and a molecular weight of 438.64 g/mol. Its IUPAC name is (E)-3-[1-[(2R)-3-[bis(2-methylpropyl)amino]-2-hydroxypropyl]indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[1-[(2R)-3-[bis(2-methylpropyl)amino]-2-hydroxypropyl]indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 92669598 |
| Molecular Formula | C26H34N2O2S |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (E)-3-[1-[(2R)-3-[bis(2-methylpropyl)amino]-2-hydroxypropyl]indol-3-yl]-1-thiophen-2-ylprop-2-en-1-one |
| SMILES | CC(C)CN(CC(C)C)C[C@@H](O)Cn1cc(/C=C/C(=O)c2cccs2)c2ccccc21 |
| InChI | InChI=1S/C26H34N2O2S/c1-19(2)14-27(15-20(3)4)17-22(29)18-28-16-21(23-8-5-6-9-24(23)28)11-12-25(30)26-10-7-13-31-26/h5-13,16,19-20,22,29H,14-15,17-18H2,1-4H3/b12-11+/t22-/m1/s1 |
| InChIKey | QTMRIMFELBWHMJ-VDZCTEQFSA-N |
| XLogP | 5.57 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|