C21H12Cl3NO — CID 42600227
(3Z)-3-[(2-chlorophenyl)methylidene]-1-(2,6-dichlorophenyl)indol-2-one (PubChem CID 42600227) has the molecular formula C21H12Cl3NO and a molecular weight of 400.69 g/mol. Its IUPAC name is (3Z)-3-[(2-chlorophenyl)methylidene]-1-(2,6-dichlorophenyl)indol-2-one.
| Compound Name | (3Z)-3-[(2-chlorophenyl)methylidene]-1-(2,6-dichlorophenyl)indol-2-one |
|---|---|
| PubChem CID | 42600227 |
| Molecular Formula | C21H12Cl3NO |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | (3Z)-3-[(2-chlorophenyl)methylidene]-1-(2,6-dichlorophenyl)indol-2-one |
| SMILES | O=C1/C(=C\c2ccccc2Cl)c2ccccc2N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H12Cl3NO/c22-16-8-3-1-6-13(16)12-15-14-7-2-4-11-19(14)25(21(15)26)20-17(23)9-5-10-18(20)24/h1-12H/b15-12- |
| InChIKey | IMDOTPAZGALFAU-QINSGFPZSA-N |
| XLogP | 6.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|