C14H9Cl2NO — CID 27211
1-(2,6-dichlorophenyl)-3H-indol-2-one (PubChem CID 27211) has the molecular formula C14H9Cl2NO and a molecular weight of 278.14 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3H-indol-2-one.
| Compound Name | 1-(2,6-dichlorophenyl)-3H-indol-2-one |
|---|---|
| PubChem CID | 27211 |
| Molecular Formula | C14H9Cl2NO |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3H-indol-2-one |
| SMILES | O=C1Cc2ccccc2N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H9Cl2NO/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(17)18/h1-7H,8H2 |
| InChIKey | JCICIFOYVSPMHG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |