C8H6ClNO — CID 3731010
7-chloro-1,3-dihydroindol-2-one (PubChem CID 3731010) has the molecular formula C8H6ClNO and a molecular weight of 167.59 g/mol. Its IUPAC name is 7-chloro-1,3-dihydroindol-2-one.
| Compound Name | 7-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 3731010 |
| Molecular Formula | C8H6ClNO |
| Molecular Weight | 167.59 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | 7-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cccc(Cl)c2N1 |
| InChI | InChI=1S/C8H6ClNO/c9-6-3-1-2-5-4-7(11)10-8(5)6/h1-3H,4H2,(H,10,11) |
| InChIKey | FPDLUAACCNVSQA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.59 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |