C13H7Cl2NOSe — CID 166626801
2-(2,4-dichlorophenyl)-1,2-benzoselenazol-3-one (PubChem CID 166626801) has the molecular formula C13H7Cl2NOSe and a molecular weight of 343.07 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1,2-benzoselenazol-3-one.
| Compound Name | 2-(2,4-dichlorophenyl)-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 166626801 |
| Molecular Formula | C13H7Cl2NOSe |
| Molecular Weight | 343.07 g/mol |
| Exact Mass | 342.91 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl2NOSe/c14-8-5-6-11(10(15)7-8)16-13(17)9-3-1-2-4-12(9)18-16/h1-7H |
| InChIKey | BALAFTQNUGNRHQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.07 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|