C30H27ClFN3O4S — CID 4979784
3-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 4979784) has the molecular formula C30H27ClFN3O4S and a molecular weight of 580.08 g/mol. Its IUPAC name is 3-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | 3-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 4979784 |
| Molecular Formula | C30H27ClFN3O4S |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | 3-[[1-[(2-chloro-6-fluorophenyl)methyl]indol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CCN1C(=O)C(=Cc2cn(Cc3c(F)cccc3Cl)c3ccccc23)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C30H27ClFN3O4S/c1-2-35-29-11-10-21(40(37,38)34-12-14-39-15-13-34)17-23(29)24(30(35)36)16-20-18-33(28-9-4-3-6-22(20)28)19-25-26(31)7-5-8-27(25)32/h3-11,16-18H,2,12-15,19H2,1H3 |
| InChIKey | UMQBZRCBCIGNHI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|