C32H33N3O6S — CID 4979808
1-ethyl-3-[[1-[2-(4-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 4979808) has the molecular formula C32H33N3O6S and a molecular weight of 587.70 g/mol. Its IUPAC name is 1-ethyl-3-[[1-[2-(4-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | 1-ethyl-3-[[1-[2-(4-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 4979808 |
| Molecular Formula | C32H33N3O6S |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 1-ethyl-3-[[1-[2-(4-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CCN1C(=O)C(=Cc2cn(CCOc3ccc(OC)cc3)c3ccccc23)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C32H33N3O6S/c1-3-35-31-13-12-26(42(37,38)34-15-17-40-18-16-34)21-28(31)29(32(35)36)20-23-22-33(30-7-5-4-6-27(23)30)14-19-41-25-10-8-24(39-2)9-11-25/h4-13,20-22H,3,14-19H2,1-2H3 |
| InChIKey | GWSMXFQLSRCDCK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|